C14H20N2O5 — CID 80537759
4-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]-2-methylbutanoic acid (PubChem CID 80537759) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 4-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]-2-methylbutanoic acid.
| Compound Name | 4-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 80537759 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-[[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]amino]-2-methylbutanoic acid |
| SMILES | CC(CCNC(=O)[C@@H](N)Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C14H20N2O5/c1-8(14(20)21)4-5-16-13(19)10(15)6-9-2-3-11(17)12(18)7-9/h2-3,7-8,10,17-18H,4-6,15H2,1H3,(H,16,19)(H,20,21)/t8?,10-/m0/s1 |
| InChIKey | TXBAHEXVLZLXDA-HTLJXXAVSA-N |
| XLogP | 0.19 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|