C20H26O4 — CID 159514166
4-[3-[(3,4-dihydroxyphenyl)methyl]-2-ethylpentyl]benzene-1,2-diol (PubChem CID 159514166) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 4-[3-[(3,4-dihydroxyphenyl)methyl]-2-ethylpentyl]benzene-1,2-diol.
| Compound Name | 4-[3-[(3,4-dihydroxyphenyl)methyl]-2-ethylpentyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 159514166 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 4-[3-[(3,4-dihydroxyphenyl)methyl]-2-ethylpentyl]benzene-1,2-diol |
| SMILES | CCC(Cc1ccc(O)c(O)c1)C(CC)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C20H26O4/c1-3-15(9-13-5-7-17(21)19(23)11-13)16(4-2)10-14-6-8-18(22)20(24)12-14/h5-8,11-12,15-16,21-24H,3-4,9-10H2,1-2H3 |
| InChIKey | MAYUQLRYXIZAIV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|