C26H38O4 — CID 172869127
4-[(2R,3R)-2-butyl-3-[(3,4-dihydroxyphenyl)methyl]nonyl]benzene-1,2-diol (PubChem CID 172869127) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is 4-[(2R,3R)-2-butyl-3-[(3,4-dihydroxyphenyl)methyl]nonyl]benzene-1,2-diol.
| Compound Name | 4-[(2R,3R)-2-butyl-3-[(3,4-dihydroxyphenyl)methyl]nonyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 172869127 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 4-[(2R,3R)-2-butyl-3-[(3,4-dihydroxyphenyl)methyl]nonyl]benzene-1,2-diol |
| SMILES | CCCCCC[C@H](Cc1ccc(O)c(O)c1)[C@H](CCCC)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C26H38O4/c1-3-5-7-8-10-22(16-20-12-14-24(28)26(30)18-20)21(9-6-4-2)15-19-11-13-23(27)25(29)17-19/h11-14,17-18,21-22,27-30H,3-10,15-16H2,1-2H3/t21-,22-/m1/s1 |
| InChIKey | PNLJHGYMYSIMAE-FGZHOGPDSA-N |
| XLogP | 6.69 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|