C17H29NO4 — CID 143324744
4-(2-amino-3-hydroxy-3-octoxypropyl)benzene-1,2-diol (PubChem CID 143324744) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is 4-(2-amino-3-hydroxy-3-octoxypropyl)benzene-1,2-diol.
| Compound Name | 4-(2-amino-3-hydroxy-3-octoxypropyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 143324744 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 4-(2-amino-3-hydroxy-3-octoxypropyl)benzene-1,2-diol |
| SMILES | CCCCCCCCOC(O)C(N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H29NO4/c1-2-3-4-5-6-7-10-22-17(21)14(18)11-13-8-9-15(19)16(20)12-13/h8-9,12,14,17,19-21H,2-7,10-11,18H2,1H3 |
| InChIKey | NGFDSQAKLRFOAN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|