C14H21NO4 — CID 176729148
butyl (3S)-3-amino-4-(3,4-dihydroxyphenyl)butanoate (PubChem CID 176729148) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is butyl (3S)-3-amino-4-(3,4-dihydroxyphenyl)butanoate.
| Compound Name | butyl (3S)-3-amino-4-(3,4-dihydroxyphenyl)butanoate |
|---|---|
| PubChem CID | 176729148 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | butyl (3S)-3-amino-4-(3,4-dihydroxyphenyl)butanoate |
| SMILES | CCCCOC(=O)C[C@@H](N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H21NO4/c1-2-3-6-19-14(18)9-11(15)7-10-4-5-12(16)13(17)8-10/h4-5,8,11,16-17H,2-3,6-7,9,15H2,1H3/t11-/m0/s1 |
| InChIKey | XWZRIGBINPLUMF-NSHDSACASA-N |
| XLogP | 1.70 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|