C11H14O5 — CID 162882690
ethyl (2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoate (PubChem CID 162882690) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is ethyl (2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoate.
| Compound Name | ethyl (2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 162882690 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | ethyl (2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoate |
| SMILES | CCOC(=O)[C@H](O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H14O5/c1-2-16-11(15)10(14)6-7-3-4-8(12)9(13)5-7/h3-5,10,12-14H,2,6H2,1H3/t10-/m1/s1 |
| InChIKey | PFNTZFUZCHVMEE-SNVBAGLBSA-N |
| XLogP | 0.56 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|