C14H17FO5 — CID 71321162
diethyl 2-[(3-fluoro-4-hydroxyphenyl)methyl]propanedioate (PubChem CID 71321162) has the molecular formula C14H17FO5 and a molecular weight of 284.28 g/mol. Its IUPAC name is diethyl 2-[(3-fluoro-4-hydroxyphenyl)methyl]propanedioate.
| Compound Name | diethyl 2-[(3-fluoro-4-hydroxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 71321162 |
| Molecular Formula | C14H17FO5 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | diethyl 2-[(3-fluoro-4-hydroxyphenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1ccc(O)c(F)c1)C(=O)OCC |
| InChI | InChI=1S/C14H17FO5/c1-3-19-13(17)10(14(18)20-4-2)7-9-5-6-12(16)11(15)8-9/h5-6,8,10,16H,3-4,7H2,1-2H3 |
| InChIKey | PXHOLDSQFAWQOQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|