C12H15NO4 — CID 121013946
ethyl 3-amino-2-[(4-hydroxyphenyl)methyl]-3-oxopropanoate (PubChem CID 121013946) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is ethyl 3-amino-2-[(4-hydroxyphenyl)methyl]-3-oxopropanoate.
| Compound Name | ethyl 3-amino-2-[(4-hydroxyphenyl)methyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 121013946 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | ethyl 3-amino-2-[(4-hydroxyphenyl)methyl]-3-oxopropanoate |
| SMILES | CCOC(=O)C(Cc1ccc(O)cc1)C(N)=O |
| InChI | InChI=1S/C12H15NO4/c1-2-17-12(16)10(11(13)15)7-8-3-5-9(14)6-4-8/h3-6,10,14H,2,7H2,1H3,(H2,13,15) |
| InChIKey | SOSJMMYSFJBWHH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|