C14H19NO5 — CID 140570565
ethyl (2R,4S)-4-amino-2-(hydroxymethyl)-5-(4-hydroxyphenyl)-3-oxopentanoate (PubChem CID 140570565) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is ethyl (2R,4S)-4-amino-2-(hydroxymethyl)-5-(4-hydroxyphenyl)-3-oxopentanoate.
| Compound Name | ethyl (2R,4S)-4-amino-2-(hydroxymethyl)-5-(4-hydroxyphenyl)-3-oxopentanoate |
|---|---|
| PubChem CID | 140570565 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | ethyl (2R,4S)-4-amino-2-(hydroxymethyl)-5-(4-hydroxyphenyl)-3-oxopentanoate |
| SMILES | CCOC(=O)[C@H](CO)C(=O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H19NO5/c1-2-20-14(19)11(8-16)13(18)12(15)7-9-3-5-10(17)6-4-9/h3-6,11-12,16-17H,2,7-8,15H2,1H3/t11-,12+/m1/s1 |
| InChIKey | CAAYBMZMLRAPCT-NEPJUHHUSA-N |
| XLogP | 0.00 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|