C11H17NO5 — CID 70443356
2-amino-3-(4-hydroxyphenyl)propanoic acid;methoxymethanol (PubChem CID 70443356) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxyphenyl)propanoic acid;methoxymethanol.
| Compound Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;methoxymethanol |
|---|---|
| PubChem CID | 70443356 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)propanoic acid;methoxymethanol |
| SMILES | COCO.NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO3.C2H6O2/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;1-4-2-3/h1-4,8,11H,5,10H2,(H,12,13);3H,2H2,1H3 |
| InChIKey | ZFOYGAVELXLDSH-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|