C11H19FN2O3 — CID 174185401
azane;ethyl 2-amino-3-(4-hydroxyphenyl)propanoate;hydrofluoride (PubChem CID 174185401) has the molecular formula C11H19FN2O3 and a molecular weight of 246.28 g/mol. Its IUPAC name is azane;ethyl 2-amino-3-(4-hydroxyphenyl)propanoate;hydrofluoride.
| Compound Name | azane;ethyl 2-amino-3-(4-hydroxyphenyl)propanoate;hydrofluoride |
|---|---|
| PubChem CID | 174185401 |
| Molecular Formula | C11H19FN2O3 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | azane;ethyl 2-amino-3-(4-hydroxyphenyl)propanoate;hydrofluoride |
| SMILES | CCOC(=O)C(N)Cc1ccc(O)cc1.F.N |
| InChI | InChI=1S/C11H15NO3.FH.H3N/c1-2-15-11(14)10(12)7-8-3-5-9(13)6-4-8;;/h3-6,10,13H,2,7,12H2,1H3;1H;1H3 |
| InChIKey | ARNDQCWKOIUKRV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |