C15H17NO3 — CID 18625802
ethyl 3-(4-hydroxyphenyl)-2-pyrrol-1-ylpropanoate (PubChem CID 18625802) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is ethyl 3-(4-hydroxyphenyl)-2-pyrrol-1-ylpropanoate.
| Compound Name | ethyl 3-(4-hydroxyphenyl)-2-pyrrol-1-ylpropanoate |
|---|---|
| PubChem CID | 18625802 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | ethyl 3-(4-hydroxyphenyl)-2-pyrrol-1-ylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccc(O)cc1)n1cccc1 |
| InChI | InChI=1S/C15H17NO3/c1-2-19-15(18)14(16-9-3-4-10-16)11-12-5-7-13(17)8-6-12/h3-10,14,17H,2,11H2,1H3 |
| InChIKey | OSADYDJUPTXYKV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |