C20H23NO7 — CID 101478667
diethyl 1-[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]pyrrole-3,4-dicarboxylate (PubChem CID 101478667) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is diethyl 1-[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]pyrrole-3,4-dicarboxylate.
| Compound Name | diethyl 1-[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101478667 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | diethyl 1-[(2S)-3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]pyrrole-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1cn([C@@H](Cc2ccc(O)cc2)C(=O)OC)cc1C(=O)OCC |
| InChI | InChI=1S/C20H23NO7/c1-4-27-18(23)15-11-21(12-16(15)19(24)28-5-2)17(20(25)26-3)10-13-6-8-14(22)9-7-13/h6-9,11-12,17,22H,4-5,10H2,1-3H3/t17-/m0/s1 |
| InChIKey | XAIIPMPTEHQZAZ-KRWDZBQOSA-N |
| XLogP | 2.50 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|