C18H11F4NO5 — CID 4663260
methyl 3-(4-hydroxyphenyl)-2-(4,5,6,7-tetrafluoro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 4663260) has the molecular formula C18H11F4NO5 and a molecular weight of 397.28 g/mol. Its IUPAC name is methyl 3-(4-hydroxyphenyl)-2-(4,5,6,7-tetrafluoro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | methyl 3-(4-hydroxyphenyl)-2-(4,5,6,7-tetrafluoro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 4663260 |
| Molecular Formula | C18H11F4NO5 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | methyl 3-(4-hydroxyphenyl)-2-(4,5,6,7-tetrafluoro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(O)cc1)N1C(=O)c2c(F)c(F)c(F)c(F)c2C1=O |
| InChI | InChI=1S/C18H11F4NO5/c1-28-18(27)9(6-7-2-4-8(24)5-3-7)23-16(25)10-11(17(23)26)13(20)15(22)14(21)12(10)19/h2-5,9,24H,6H2,1H3 |
| InChIKey | IFFYSFBZAPPJIU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|