C25H14BrCl4NO6 — CID 3379838
[2-(4-bromophenyl)-2-oxoethyl] 3-(4-hydroxyphenyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 3379838) has the molecular formula C25H14BrCl4NO6 and a molecular weight of 646.10 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 3-(4-hydroxyphenyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 3-(4-hydroxyphenyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 3379838 |
| Molecular Formula | C25H14BrCl4NO6 |
| Molecular Weight | 646.10 g/mol |
| Exact Mass | 642.88 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 3-(4-hydroxyphenyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(COC(=O)C(Cc1ccc(O)cc1)N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H14BrCl4NO6/c26-13-5-3-12(4-6-13)16(33)10-37-25(36)15(9-11-1-7-14(32)8-2-11)31-23(34)17-18(24(31)35)20(28)22(30)21(29)19(17)27/h1-8,15,32H,9-10H2 |
| InChIKey | CQHFPKVQKGBKET-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.10 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|