C32H19Cl5N2O6 — CID 99656331
[2-(2-benzoyl-4-chloroanilino)-2-oxoethyl] (2R)-3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 99656331) has the molecular formula C32H19Cl5N2O6 and a molecular weight of 704.78 g/mol. Its IUPAC name is [2-(2-benzoyl-4-chloroanilino)-2-oxoethyl] (2R)-3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(2-benzoyl-4-chloroanilino)-2-oxoethyl] (2R)-3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 99656331 |
| Molecular Formula | C32H19Cl5N2O6 |
| Molecular Weight | 704.78 g/mol |
| Exact Mass | 701.97 |
| IUPAC Name | [2-(2-benzoyl-4-chloroanilino)-2-oxoethyl] (2R)-3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | O=C(COC(=O)[C@@H](Cc1ccccc1)N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O)Nc1ccc(Cl)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C32H19Cl5N2O6/c33-18-11-12-20(19(14-18)29(41)17-9-5-2-6-10-17)38-22(40)15-45-32(44)21(13-16-7-3-1-4-8-16)39-30(42)23-24(31(39)43)26(35)28(37)27(36)25(23)34/h1-12,14,21H,13,15H2,(H,38,40)/t21-/m1/s1 |
| InChIKey | LCRLGFHMHHUPCZ-OAQYLSRUSA-N |
| XLogP | 7.57 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.78 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|