C30H24Cl4N2O7S — CID 99656320
methyl (6S)-6-methyl-2-[[2-[(2R)-3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 99656320) has the molecular formula C30H24Cl4N2O7S and a molecular weight of 698.41 g/mol. Its IUPAC name is methyl (6S)-6-methyl-2-[[2-[(2R)-3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl (6S)-6-methyl-2-[[2-[(2R)-3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 99656320 |
| Molecular Formula | C30H24Cl4N2O7S |
| Molecular Weight | 698.41 g/mol |
| Exact Mass | 696.01 |
| IUPAC Name | methyl (6S)-6-methyl-2-[[2-[(2R)-3-phenyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)COC(=O)[C@@H](Cc2ccccc2)N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)sc2c1CC[C@H](C)C2 |
| InChI | InChI=1S/C30H24Cl4N2O7S/c1-13-8-9-15-17(10-13)44-26(19(15)30(41)42-2)35-18(37)12-43-29(40)16(11-14-6-4-3-5-7-14)36-27(38)20-21(28(36)39)23(32)25(34)24(33)22(20)31/h3-7,13,16H,8-12H2,1-2H3,(H,35,37)/t13-,16+/m0/s1 |
| InChIKey | BBWKPJHTDIIOPM-XJKSGUPXSA-N |
| XLogP | 6.66 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.41 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|