C28H28I4N2O7S — CID 4206631
ethyl 6-methyl-2-[[2-[4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4206631) has the molecular formula C28H28I4N2O7S and a molecular weight of 1044.22 g/mol. Its IUPAC name is ethyl 6-methyl-2-[[2-[4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 6-methyl-2-[[2-[4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4206631 |
| Molecular Formula | C28H28I4N2O7S |
| Molecular Weight | 1044.22 g/mol |
| Exact Mass | 1043.78 |
| IUPAC Name | ethyl 6-methyl-2-[[2-[4-methyl-2-(4,5,6,7-tetraiodo-1,3-dioxoisoindol-2-yl)pentanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)C(CC(C)C)N2C(=O)c3c(I)c(I)c(I)c(I)c3C2=O)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C28H28I4N2O7S/c1-5-40-28(39)17-13-7-6-12(4)9-15(13)42-24(17)33-16(35)10-41-27(38)14(8-11(2)3)34-25(36)18-19(26(34)37)21(30)23(32)22(31)20(18)29/h11-12,14H,5-10H2,1-4H3,(H,33,35) |
| InChIKey | PEUVYSZMKZLEHY-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1044.22 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|