C26H24Br4N2O7S — CID 99656959
methyl (6R)-6-methyl-2-[[2-[(2S)-3-methyl-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)butanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 99656959) has the molecular formula C26H24Br4N2O7S and a molecular weight of 828.17 g/mol. Its IUPAC name is methyl (6R)-6-methyl-2-[[2-[(2S)-3-methyl-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)butanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl (6R)-6-methyl-2-[[2-[(2S)-3-methyl-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)butanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 99656959 |
| Molecular Formula | C26H24Br4N2O7S |
| Molecular Weight | 828.17 g/mol |
| Exact Mass | 823.80 |
| IUPAC Name | methyl (6R)-6-methyl-2-[[2-[(2S)-3-methyl-2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)butanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)COC(=O)[C@H](C(C)C)N2C(=O)c3c(Br)c(Br)c(Br)c(Br)c3C2=O)sc2c1CC[C@@H](C)C2 |
| InChI | InChI=1S/C26H24Br4N2O7S/c1-9(2)21(32-23(34)15-16(24(32)35)18(28)20(30)19(29)17(15)27)26(37)39-8-13(33)31-22-14(25(36)38-4)11-6-5-10(3)7-12(11)40-22/h9-10,21H,5-8H2,1-4H3,(H,31,33)/t10-,21+/m1/s1 |
| InChIKey | PAAFNNGPUZGFFN-UZJPJQLHSA-N |
| XLogP | 6.51 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.17 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|