C25H19Cl2N3O7S — CID 2568512
[2-(2,6-dichloro-4-sulfamoylanilino)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 2568512) has the molecular formula C25H19Cl2N3O7S and a molecular weight of 576.41 g/mol. Its IUPAC name is [2-(2,6-dichloro-4-sulfamoylanilino)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | [2-(2,6-dichloro-4-sulfamoylanilino)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 2568512 |
| Molecular Formula | C25H19Cl2N3O7S |
| Molecular Weight | 576.41 g/mol |
| Exact Mass | 575.03 |
| IUPAC Name | [2-(2,6-dichloro-4-sulfamoylanilino)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | NS(=O)(=O)c1cc(Cl)c(NC(=O)COC(=O)[C@@H](Cc2ccccc2)N2C(=O)c3ccccc3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C25H19Cl2N3O7S/c26-18-11-15(38(28,35)36)12-19(27)22(18)29-21(31)13-37-25(34)20(10-14-6-2-1-3-7-14)30-23(32)16-8-4-5-9-17(16)24(30)33/h1-9,11-12,20H,10,13H2,(H,29,31)(H2,28,35,36)/t20-/m1/s1 |
| InChIKey | XEPLRIOWTPQDTH-HXUWFJFHSA-N |
| XLogP | 3.03 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|