C27H22N2O7 — CID 55936240
methyl 3-[[2-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]amino]benzoate (PubChem CID 55936240) has the molecular formula C27H22N2O7 and a molecular weight of 486.48 g/mol. Its IUPAC name is methyl 3-[[2-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 55936240 |
| Molecular Formula | C27H22N2O7 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | methyl 3-[[2-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)COC(=O)[C@H](Cc2ccccc2)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C27H22N2O7/c1-35-26(33)18-10-7-11-19(15-18)28-23(30)16-36-27(34)22(14-17-8-3-2-4-9-17)29-24(31)20-12-5-6-13-21(20)25(29)32/h2-13,15,22H,14,16H2,1H3,(H,28,30)/t22-/m0/s1 |
| InChIKey | BXCVWLPNHKFPBI-QFIPXVFZSA-N |
| XLogP | 2.86 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|