C24H17N3O5S — CID 2443492
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 2443492) has the molecular formula C24H17N3O5S and a molecular weight of 459.48 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 2443492 |
| Molecular Formula | C24H17N3O5S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | N#Cc1ccsc1NC(=O)COC(=O)[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H17N3O5S/c25-13-16-10-11-33-21(16)26-20(28)14-32-24(31)19(12-15-6-2-1-3-7-15)27-22(29)17-8-4-5-9-18(17)23(27)30/h1-11,19H,12,14H2,(H,26,28)/t19-/m0/s1 |
| InChIKey | KXGMOGPYDXBASM-IBGZPJMESA-N |
| XLogP | 3.01 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|