C16H14N2O3S2 — CID 7806413
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate (PubChem CID 7806413) has the molecular formula C16H14N2O3S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 7806413 |
| Molecular Formula | C16H14N2O3S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (2R)-2-phenylsulfanylpropanoate |
| SMILES | C[C@@H](Sc1ccccc1)C(=O)OCC(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C16H14N2O3S2/c1-11(23-13-5-3-2-4-6-13)16(20)21-10-14(19)18-15-12(9-17)7-8-22-15/h2-8,11H,10H2,1H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | UHRUNQAYLLXKTG-LLVKDONJSA-N |
| XLogP | 3.28 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |