C16H13BrN2O4S — CID 7742987
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (2R)-2-(4-bromophenoxy)propanoate (PubChem CID 7742987) has the molecular formula C16H13BrN2O4S and a molecular weight of 409.26 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (2R)-2-(4-bromophenoxy)propanoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (2R)-2-(4-bromophenoxy)propanoate |
|---|---|
| PubChem CID | 7742987 |
| Molecular Formula | C16H13BrN2O4S |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (2R)-2-(4-bromophenoxy)propanoate |
| SMILES | C[C@@H](Oc1ccc(Br)cc1)C(=O)OCC(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C16H13BrN2O4S/c1-10(23-13-4-2-12(17)3-5-13)16(21)22-9-14(20)19-15-11(8-18)6-7-24-15/h2-7,10H,9H2,1H3,(H,19,20)/t10-/m1/s1 |
| InChIKey | UJNIDEYIOBGTJZ-SNVBAGLBSA-N |
| XLogP | 3.33 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |