C17H12F2N2O4S — CID 7996560
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 7996560) has the molecular formula C17H12F2N2O4S and a molecular weight of 378.36 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7996560 |
| Molecular Formula | C17H12F2N2O4S |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | N#Cc1ccsc1NC(=O)COC(=O)/C=C/c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H12F2N2O4S/c18-17(19)25-13-4-1-11(2-5-13)3-6-15(23)24-10-14(22)21-16-12(9-20)7-8-26-16/h1-8,17H,10H2,(H,21,22)/b6-3+ |
| InChIKey | ZJYSWNFMPZJRKX-ZZXKWVIFSA-N |
| XLogP | 3.42 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|