C19H14F2N2O4 — CID 7996846
[2-(2-cyanoanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 7996846) has the molecular formula C19H14F2N2O4 and a molecular weight of 372.33 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7996846 |
| Molecular Formula | C19H14F2N2O4 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | N#Cc1ccccc1NC(=O)COC(=O)/C=C/c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H14F2N2O4/c20-19(21)27-15-8-5-13(6-9-15)7-10-18(25)26-12-17(24)23-16-4-2-1-3-14(16)11-22/h1-10,19H,12H2,(H,23,24)/b10-7+ |
| InChIKey | CNUXYCAFBKJONX-JXMROGBWSA-N |
| XLogP | 3.35 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|