C18H13Cl2F2NO4 — CID 2414185
[2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 2414185) has the molecular formula C18H13Cl2F2NO4 and a molecular weight of 416.21 g/mol. Its IUPAC name is [2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 2414185 |
| Molecular Formula | C18H13Cl2F2NO4 |
| Molecular Weight | 416.21 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | [2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(OC(F)F)cc1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H13Cl2F2NO4/c19-12-7-13(20)9-14(8-12)23-16(24)10-26-17(25)6-3-11-1-4-15(5-2-11)27-18(21)22/h1-9,18H,10H2,(H,23,24)/b6-3+ |
| InChIKey | DFRKAVDVHSXKTI-ZZXKWVIFSA-N |
| XLogP | 4.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.21 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|