C18H13ClF2N2O6 — CID 5226366
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] 3-[4-(difluoromethoxy)phenyl]prop-2-enoate (PubChem CID 5226366) has the molecular formula C18H13ClF2N2O6 and a molecular weight of 426.76 g/mol. Its IUPAC name is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 3-[4-(difluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 5226366 |
| Molecular Formula | C18H13ClF2N2O6 |
| Molecular Weight | 426.76 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 3-[4-(difluoromethoxy)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc(OC(F)F)cc1)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C18H13ClF2N2O6/c19-14-7-4-12(23(26)27)9-15(14)22-16(24)10-28-17(25)8-3-11-1-5-13(6-2-11)29-18(20)21/h1-9,18H,10H2,(H,22,24) |
| InChIKey | MUZOVERIURIYDC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|