C20H18ClN3O8 — CID 27043311
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 27043311) has the molecular formula C20H18ClN3O8 and a molecular weight of 463.83 g/mol. Its IUPAC name is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 27043311 |
| Molecular Formula | C20H18ClN3O8 |
| Molecular Weight | 463.83 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)Nc2cc([N+](=O)[O-])ccc2Cl)ccc1OCC(N)=O |
| InChI | InChI=1S/C20H18ClN3O8/c1-30-17-8-12(2-6-16(17)31-10-18(22)25)3-7-20(27)32-11-19(26)23-15-9-13(24(28)29)4-5-14(15)21/h2-9H,10-11H2,1H3,(H2,22,25)(H,23,26)/b7-3+ |
| InChIKey | UVERCTVAKJSQLM-XVNBXDOJSA-N |
| XLogP | 2.32 |
| TPSA | 160.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.83 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|