C19H19ClN2O7 — CID 35987746
[2-(2-chloro-5-nitroanilino)-2-oxoethyl] 3-(3,4-dimethoxyphenyl)propanoate (PubChem CID 35987746) has the molecular formula C19H19ClN2O7 and a molecular weight of 422.82 g/mol. Its IUPAC name is [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 3-(3,4-dimethoxyphenyl)propanoate.
| Compound Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 3-(3,4-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 35987746 |
| Molecular Formula | C19H19ClN2O7 |
| Molecular Weight | 422.82 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | [2-(2-chloro-5-nitroanilino)-2-oxoethyl] 3-(3,4-dimethoxyphenyl)propanoate |
| SMILES | COc1ccc(CCC(=O)OCC(=O)Nc2cc([N+](=O)[O-])ccc2Cl)cc1OC |
| InChI | InChI=1S/C19H19ClN2O7/c1-27-16-7-3-12(9-17(16)28-2)4-8-19(24)29-11-18(23)21-15-10-13(22(25)26)5-6-14(15)20/h3,5-7,9-10H,4,8,11H2,1-2H3,(H,21,23) |
| InChIKey | NPAIYEFYJQCKFQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.82 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|