C17H11Cl4NO3 — CID 1191670
[2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 1191670) has the molecular formula C17H11Cl4NO3 and a molecular weight of 419.09 g/mol. Its IUPAC name is [2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 1191670 |
| Molecular Formula | C17H11Cl4NO3 |
| Molecular Weight | 419.09 g/mol |
| Exact Mass | 416.95 |
| IUPAC Name | [2-(3,5-dichloroanilino)-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(Cl)c(Cl)c1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H11Cl4NO3/c18-11-6-12(19)8-13(7-11)22-16(23)9-25-17(24)4-2-10-1-3-14(20)15(21)5-10/h1-8H,9H2,(H,22,23)/b4-2+ |
| InChIKey | DXBCNMRMBNLYDC-DUXPYHPUSA-N |
| XLogP | 5.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.09 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|