C17H11Cl3FNO3 — CID 5061427
[2-(3,5-dichloroanilino)-2-oxoethyl] 3-(2-chloro-6-fluorophenyl)prop-2-enoate (PubChem CID 5061427) has the molecular formula C17H11Cl3FNO3 and a molecular weight of 402.64 g/mol. Its IUPAC name is [2-(3,5-dichloroanilino)-2-oxoethyl] 3-(2-chloro-6-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(3,5-dichloroanilino)-2-oxoethyl] 3-(2-chloro-6-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 5061427 |
| Molecular Formula | C17H11Cl3FNO3 |
| Molecular Weight | 402.64 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | [2-(3,5-dichloroanilino)-2-oxoethyl] 3-(2-chloro-6-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1c(F)cccc1Cl)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H11Cl3FNO3/c18-10-6-11(19)8-12(7-10)22-16(23)9-25-17(24)5-4-13-14(20)2-1-3-15(13)21/h1-8H,9H2,(H,22,23) |
| InChIKey | QSKIADIOYPVSBA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.64 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|