C19H14ClFN2O3S — CID 16617544
[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate (PubChem CID 16617544) has the molecular formula C19H14ClFN2O3S and a molecular weight of 404.85 g/mol. Its IUPAC name is [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 16617544 |
| Molecular Formula | C19H14ClFN2O3S |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | [2-[(6-methyl-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] (E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate |
| SMILES | Cc1ccc2nc(NC(=O)COC(=O)/C=C/c3c(F)cccc3Cl)sc2c1 |
| InChI | InChI=1S/C19H14ClFN2O3S/c1-11-5-7-15-16(9-11)27-19(22-15)23-17(24)10-26-18(25)8-6-12-13(20)3-2-4-14(12)21/h2-9H,10H2,1H3,(H,22,23,24)/b8-6+ |
| InChIKey | SWLBVPMYJQJVCU-SOFGYWHQSA-N |
| XLogP | 4.59 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|