C25H19FN2O3S — CID 4619285
[2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 3-(4-fluorophenyl)prop-2-enoate (PubChem CID 4619285) has the molecular formula C25H19FN2O3S and a molecular weight of 446.50 g/mol. Its IUPAC name is [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4619285 |
| Molecular Formula | C25H19FN2O3S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 3-(4-fluorophenyl)prop-2-enoate |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)COC(=O)C=Cc4ccc(F)cc4)cc3)sc2c1 |
| InChI | InChI=1S/C25H19FN2O3S/c1-16-2-12-21-22(14-16)32-25(28-21)18-6-10-20(11-7-18)27-23(29)15-31-24(30)13-5-17-3-8-19(26)9-4-17/h2-14H,15H2,1H3,(H,27,29) |
| InChIKey | HQGXBQYYHOLSOC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|