C25H21N3O2S2 — CID 6276234
(E)-3-(4-methoxyphenyl)-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 6276234) has the molecular formula C25H21N3O2S2 and a molecular weight of 459.60 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 6276234 |
| Molecular Formula | C25H21N3O2S2 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(=S)Nc2ccc(-c3nc4ccc(C)cc4s3)cc2)cc1 |
| InChI | InChI=1S/C25H21N3O2S2/c1-16-3-13-21-22(15-16)32-24(27-21)18-7-9-19(10-8-18)26-25(31)28-23(29)14-6-17-4-11-20(30-2)12-5-17/h3-15H,1-2H3,(H2,26,28,29,31)/b14-6+ |
| InChIKey | MYXDKUHCDNXYOR-MKMNVTDBSA-N |
| XLogP | 5.81 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|