C24H21N3O2S2 — CID 5169288
2-(4-methoxyphenyl)-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]acetamide (PubChem CID 5169288) has the molecular formula C24H21N3O2S2 and a molecular weight of 447.59 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 5169288 |
| Molecular Formula | C24H21N3O2S2 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]acetamide |
| SMILES | COc1ccc(CC(=O)NC(=S)Nc2ccc(-c3nc4ccc(C)cc4s3)cc2)cc1 |
| InChI | InChI=1S/C24H21N3O2S2/c1-15-3-12-20-21(13-15)31-23(26-20)17-6-8-18(9-7-17)25-24(30)27-22(28)14-16-4-10-19(29-2)11-5-16/h3-13H,14H2,1-2H3,(H2,25,27,28,30) |
| InChIKey | WSIUJLYYPSKLCD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|