C28H23N3O2S2 — CID 4315124
5-(3,4-dimethylphenyl)-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 4315124) has the molecular formula C28H23N3O2S2 and a molecular weight of 497.65 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(3,4-dimethylphenyl)-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4315124 |
| Molecular Formula | C28H23N3O2S2 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=S)NC(=O)c4ccc(-c5ccc(C)c(C)c5)o4)cc3)sc2c1 |
| InChI | InChI=1S/C28H23N3O2S2/c1-16-4-11-22-25(14-16)35-27(30-22)19-7-9-21(10-8-19)29-28(34)31-26(32)24-13-12-23(33-24)20-6-5-17(2)18(3)15-20/h4-15H,1-3H3,(H2,29,31,32,34) |
| InChIKey | ZFJGIHHRKALKKT-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|