C29H22ClN3O2S2 — CID 21169213
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 21169213) has the molecular formula C29H22ClN3O2S2 and a molecular weight of 544.10 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 21169213 |
| Molecular Formula | C29H22ClN3O2S2 |
| Molecular Weight | 544.10 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=S)NC(=O)/C=C/c4ccc(-c5ccc(C)c(Cl)c5)o4)cc3)sc2c1 |
| InChI | InChI=1S/C29H22ClN3O2S2/c1-17-3-12-24-26(15-17)37-28(32-24)19-6-8-21(9-7-19)31-29(36)33-27(34)14-11-22-10-13-25(35-22)20-5-4-18(2)23(30)16-20/h3-16H,1-2H3,(H2,31,33,34,36)/b14-11+ |
| InChIKey | WHVRLFZDIHBRSO-SDNWHVSQSA-N |
| XLogP | 8.02 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.10 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|