C24H20ClN3O2S2 — CID 23098104
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(4,7-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]prop-2-enamide (PubChem CID 23098104) has the molecular formula C24H20ClN3O2S2 and a molecular weight of 482.03 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(4,7-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(4,7-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 23098104 |
| Molecular Formula | C24H20ClN3O2S2 |
| Molecular Weight | 482.03 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(4,7-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)NC(=S)Nc3nc4c(C)ccc(C)c4s3)o2)cc1Cl |
| InChI | InChI=1S/C24H20ClN3O2S2/c1-13-6-7-16(12-18(13)25)19-10-8-17(30-19)9-11-20(29)26-23(31)28-24-27-21-14(2)4-5-15(3)22(21)32-24/h4-12H,1-3H3,(H2,26,27,28,29,31)/b11-9+ |
| InChIKey | BKDADQOFOJLGJI-PKNBQFBNSA-N |
| XLogP | 6.66 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.03 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|