C20H15ClIN3O2S — CID 21167746
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(5-iodo-2-pyridinyl)carbamothioyl]prop-2-enamide (PubChem CID 21167746) has the molecular formula C20H15ClIN3O2S and a molecular weight of 523.78 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(5-iodo-2-pyridinyl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(5-iodo-2-pyridinyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 21167746 |
| Molecular Formula | C20H15ClIN3O2S |
| Molecular Weight | 523.78 g/mol |
| Exact Mass | 522.96 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(5-iodo-2-pyridinyl)carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)NC(=S)Nc3ccc(I)cn3)o2)cc1Cl |
| InChI | InChI=1S/C20H15ClIN3O2S/c1-12-2-3-13(10-16(12)21)17-7-5-15(27-17)6-9-19(26)25-20(28)24-18-8-4-14(22)11-23-18/h2-11H,1H3,(H2,23,24,25,26,28)/b9-6+ |
| InChIKey | FULMZAQIDUGATQ-RMKNXTFCSA-N |
| XLogP | 5.43 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.78 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|