C23H21ClN2O3S — CID 22781314
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]prop-2-enamide (PubChem CID 22781314) has the molecular formula C23H21ClN2O3S and a molecular weight of 440.95 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 22781314 |
| Molecular Formula | C23H21ClN2O3S |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]prop-2-enamide |
| SMILES | Cc1cc(C)c(O)c(NC(=S)NC(=O)/C=C/c2ccc(-c3ccc(C)c(Cl)c3)o2)c1 |
| InChI | InChI=1S/C23H21ClN2O3S/c1-13-10-15(3)22(28)19(11-13)25-23(30)26-21(27)9-7-17-6-8-20(29-17)16-5-4-14(2)18(24)12-16/h4-12,28H,1-3H3,(H2,25,26,27,30)/b9-7+ |
| InChIKey | CCHPQUGACJAURN-VQHVLOKHSA-N |
| XLogP | 5.76 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|