C25H24Cl2N2O3S — CID 23100391
(E)-N-[(5-tert-butyl-3-chloro-2-hydroxyphenyl)carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide (PubChem CID 23100391) has the molecular formula C25H24Cl2N2O3S and a molecular weight of 503.45 g/mol. Its IUPAC name is (E)-N-[(5-tert-butyl-3-chloro-2-hydroxyphenyl)carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[(5-tert-butyl-3-chloro-2-hydroxyphenyl)carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 23100391 |
| Molecular Formula | C25H24Cl2N2O3S |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | (E)-N-[(5-tert-butyl-3-chloro-2-hydroxyphenyl)carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)NC(=S)Nc3cc(C(C)(C)C)cc(Cl)c3O)o2)cc1Cl |
| InChI | InChI=1S/C25H24Cl2N2O3S/c1-14-5-6-15(11-18(14)26)21-9-7-17(32-21)8-10-22(30)29-24(33)28-20-13-16(25(2,3)4)12-19(27)23(20)31/h5-13,31H,1-4H3,(H2,28,29,30,33)/b10-8+ |
| InChIKey | XUGZEXJHQLJRRZ-CSKARUKUSA-N |
| XLogP | 7.09 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|