C32H28ClN3O3S — CID 21170543
(E)-N-[[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide (PubChem CID 21170543) has the molecular formula C32H28ClN3O3S and a molecular weight of 570.11 g/mol. Its IUPAC name is (E)-N-[[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 21170543 |
| Molecular Formula | C32H28ClN3O3S |
| Molecular Weight | 570.11 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | (E)-N-[[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)NC(=S)Nc3ccc4oc(-c5ccc(C(C)(C)C)cc5)nc4c3)o2)cc1Cl |
| InChI | InChI=1S/C32H28ClN3O3S/c1-19-5-6-21(17-25(19)33)27-15-12-24(38-27)13-16-29(37)36-31(40)34-23-11-14-28-26(18-23)35-30(39-28)20-7-9-22(10-8-20)32(2,3)4/h5-18H,1-4H3,(H2,34,36,37,40)/b16-13+ |
| InChIKey | SJSDRTZHGROZDB-DTQAZKPQSA-N |
| XLogP | 8.54 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.11 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|