C31H27ClN2O3 — CID 23101090
(E)-N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide (PubChem CID 23101090) has the molecular formula C31H27ClN2O3 and a molecular weight of 511.02 g/mol. Its IUPAC name is (E)-N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 23101090 |
| Molecular Formula | C31H27ClN2O3 |
| Molecular Weight | 511.02 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | (E)-N-[2-(4-tert-butylphenyl)-1,3-benzoxazol-5-yl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)Nc3ccc4oc(-c5ccc(C(C)(C)C)cc5)nc4c3)o2)cc1Cl |
| InChI | InChI=1S/C31H27ClN2O3/c1-19-5-6-21(17-25(19)32)27-15-12-24(36-27)13-16-29(35)33-23-11-14-28-26(18-23)34-30(37-28)20-7-9-22(10-8-20)31(2,3)4/h5-18H,1-4H3,(H,33,35)/b16-13+ |
| InChIKey | CAGVYOHPKKRKNF-DTQAZKPQSA-N |
| XLogP | 8.67 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.02 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|