C27H18BrClN2O3 — CID 3449234
N-[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide (PubChem CID 3449234) has the molecular formula C27H18BrClN2O3 and a molecular weight of 533.81 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3449234 |
| Molecular Formula | C27H18BrClN2O3 |
| Molecular Weight | 533.81 g/mol |
| Exact Mass | 532.02 |
| IUPAC Name | N-[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(C=CC(=O)Nc3ccc4oc(-c5ccc(Br)cc5)nc4c3)o2)cc1Cl |
| InChI | InChI=1S/C27H18BrClN2O3/c1-16-2-3-18(14-22(16)29)24-12-9-21(33-24)10-13-26(32)30-20-8-11-25-23(15-20)31-27(34-25)17-4-6-19(28)7-5-17/h2-15H,1H3,(H,30,32) |
| InChIKey | ONSGDWRDYGNNOH-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.81 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|