C28H20Cl2N2O3 — CID 6159263
(E)-N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide (PubChem CID 6159263) has the molecular formula C28H20Cl2N2O3 and a molecular weight of 503.39 g/mol. Its IUPAC name is (E)-N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6159263 |
| Molecular Formula | C28H20Cl2N2O3 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | (E)-N-[2-chloro-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc2oc(-c3ccc(Cl)c(NC(=O)/C=C/c4ccc(-c5ccc(C)c(Cl)c5)o4)c3)nc2c1 |
| InChI | InChI=1S/C28H20Cl2N2O3/c1-16-3-10-26-24(13-16)32-28(35-26)19-6-9-21(29)23(15-19)31-27(33)12-8-20-7-11-25(34-20)18-5-4-17(2)22(30)14-18/h3-15H,1-2H3,(H,31,33)/b12-8+ |
| InChIKey | JSBSHGUUEOVVLW-XYOKQWHBSA-N |
| XLogP | 8.33 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|