C29H21Cl2N3O3S — CID 3547133
3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 3547133) has the molecular formula C29H21Cl2N3O3S and a molecular weight of 562.48 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3547133 |
| Molecular Formula | C29H21Cl2N3O3S |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc2oc(-c3ccc(C)c(NC(=S)NC(=O)C=Cc4ccc(-c5cccc(Cl)c5Cl)o4)c3)nc2c1 |
| InChI | InChI=1S/C29H21Cl2N3O3S/c1-16-6-11-25-23(14-16)32-28(37-25)18-8-7-17(2)22(15-18)33-29(38)34-26(35)13-10-19-9-12-24(36-19)20-4-3-5-21(30)27(20)31/h3-15H,1-2H3,(H2,33,34,35,38) |
| InChIKey | JWVIKKUKFWFHKJ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|