C27H15Cl4N3O3S — CID 3896559
N-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 3896559) has the molecular formula C27H15Cl4N3O3S and a molecular weight of 603.31 g/mol. Its IUPAC name is N-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3896559 |
| Molecular Formula | C27H15Cl4N3O3S |
| Molecular Weight | 603.31 g/mol |
| Exact Mass | 600.96 |
| IUPAC Name | N-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)NC(=S)Nc1ccc2oc(-c3ccc(Cl)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C27H15Cl4N3O3S/c28-18-8-4-14(12-20(18)30)26-33-21-13-15(5-9-23(21)37-26)32-27(38)34-24(35)11-7-16-6-10-22(36-16)17-2-1-3-19(29)25(17)31/h1-13H,(H2,32,34,35,38) |
| InChIKey | ZXHMMVNCLZYKBT-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.31 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|