C28H19Cl2N3O4S — CID 3598182
3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 3598182) has the molecular formula C28H19Cl2N3O4S and a molecular weight of 564.45 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3598182 |
| Molecular Formula | C28H19Cl2N3O4S |
| Molecular Weight | 564.45 g/mol |
| Exact Mass | 563.05 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc2oc(-c3cc(NC(=S)NC(=O)C=Cc4ccc(-c5cccc(Cl)c5Cl)o4)ccc3O)nc2c1 |
| InChI | InChI=1S/C28H19Cl2N3O4S/c1-15-5-10-24-21(13-15)32-27(37-24)19-14-16(6-9-22(19)34)31-28(38)33-25(35)12-8-17-7-11-23(36-17)18-3-2-4-20(29)26(18)30/h2-14,34H,1H3,(H2,31,33,35,38) |
| InChIKey | YNCAOZFRUAFGHC-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.45 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|