C26H15BrCl2N4O3S — CID 5021616
N-[[2-(5-bromo-3-pyridinyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 5021616) has the molecular formula C26H15BrCl2N4O3S and a molecular weight of 614.31 g/mol. Its IUPAC name is N-[[2-(5-bromo-3-pyridinyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[[2-(5-bromo-3-pyridinyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 5021616 |
| Molecular Formula | C26H15BrCl2N4O3S |
| Molecular Weight | 614.31 g/mol |
| Exact Mass | 611.94 |
| IUPAC Name | N-[[2-(5-bromo-3-pyridinyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)NC(=S)Nc1ccc2oc(-c3cncc(Br)c3)nc2c1 |
| InChI | InChI=1S/C26H15BrCl2N4O3S/c27-15-10-14(12-30-13-15)25-32-20-11-16(4-7-22(20)36-25)31-26(37)33-23(34)9-6-17-5-8-21(35-17)18-2-1-3-19(28)24(18)29/h1-13H,(H2,31,33,34,37) |
| InChIKey | MBRBKECXNDPKMV-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.31 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|